Difference between revisions of "CHC T00008638001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13304 RXN-13304] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13304 RXN-13304] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
+
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
−
* common name:
+
−
** 4-hydroxybenzoyl-CoA
+
−
* molecular weight:
+
−
** 883.61   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-hydroxybenzoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11246]]
+
** 1 [[CPD-14277]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-14282]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (3R)-3-hydroxy-lignoceroyl-CoA[c] '''=>''' 1 H2O[c] '''+''' 1 trans-lignocer-2-enoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
 +
** '''8''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[gap-filling]]:
 +
** [[meneco]]:
 +
*** [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266585 45266585]
+
{{#set: ec number=EC-4.2.1.134}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7036}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57356 57356]
+
{{#set: reconstruction category=gap-filling}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=meneco}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02949 C02949]
+
{{#set: reconstruction source=added for gapfilling}}
−
* HMDB : HMDB06467
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J}}
+
−
{{#set: common name=4-hydroxybenzoyl-CoA}}
+
−
{{#set: molecular weight=883.61    }}
+
−
{{#set: common name=p-hydroxybenzoyl-CoA}}
+
−
{{#set: produced by=RXN-11246}}
+

Revision as of 11:03, 18 January 2018

Reaction RXN-13304

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (3R)-3-hydroxy-lignoceroyl-CoA[c] => 1 H2O[c] + 1 trans-lignocer-2-enoyl-CoA[c]

Genes associated with this reaction

Pathways

  • PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
    • 8 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008638001&oldid=6185"