Difference between revisions of "ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42."

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00010194001 == * left end position: ** 106245 * transcription direction: ** NEGATIVE * right end position: ** 106568 * centisome position: ** 68...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1063 CPD0-1063] == * smiles: ** C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O) * in...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene CHC_T00010194001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1063 CPD0-1063] ==
−
* left end position:
+
* smiles:
−
** 106245
+
** C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K
−
* right end position:
+
* common name:
−
** 106568
+
** 2-O-(6-phospho-α-D-mannosyl)-D-glycerate
−
* centisome position:
+
* molecular weight:
−
** 68.18576    
+
** 345.176    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2(α-D-mannosyl-6-phosphate)-D-glycerate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPSYN-RXN]]
+
* [[RXN0-5216]]
−
** original_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-7219]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=106245}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16699 C16699]
−
{{#set: right end position=106568}}
+
* CHEBI:
−
{{#set: centisome position=68.18576   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60331 60331]
−
{{#set: reaction associated=ATPSYN-RXN}}
+
* BIGG : man6pglyc
−
{{#set: pathway associated=PWY-7219}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906104 46906104]
 +
* HMDB : HMDB12152
 +
{{#set: smiles=C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)}}
 +
{{#set: inchi key=InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K}}
 +
{{#set: common name=2-O-(6-phospho-α-D-mannosyl)-D-glycerate}}
 +
{{#set: molecular weight=345.176   }}
 +
{{#set: common name=2(α-D-mannosyl-6-phosphate)-D-glycerate}}
 +
{{#set: consumed by=RXN0-5216}}

Revision as of 11:04, 18 January 2018

Metabolite CPD0-1063

  • smiles:
    • C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)
  • inchi key:
    • InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K
  • common name:
    • 2-O-(6-phospho-α-D-mannosyl)-D-glycerate
  • molecular weight:
    • 345.176
  • Synonym(s):
    • 2(α-D-mannosyl-6-phosphate)-D-glycerate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.&oldid=6209"