Difference between revisions of "Amino-Acids"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12122 CPD-12122] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == |
* smiles: | * smiles: | ||
| − | ** CC | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N |
* common name: | * common name: | ||
| − | ** demethylmenaquinol- | + | ** demethylmenaquinol-7 |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 636.999 |
* Synonym(s): | * Synonym(s): | ||
| − | ** DMKH2- | + | ** DMKH2-7 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9191]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479205 45479205] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64806 64806] |
| − | {{#set: smiles=CC | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N}} |
| − | {{#set: common name=demethylmenaquinol- | + | {{#set: common name=demethylmenaquinol-7}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=636.999 }} |
| − | {{#set: common name=DMKH2- | + | {{#set: common name=DMKH2-7}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-9191}} |
Revision as of 12:05, 18 January 2018
Contents
Metabolite CPD-12117
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
- inchi key:
- InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N
- common name:
- demethylmenaquinol-7
- molecular weight:
- 636.999
- Synonym(s):
- DMKH2-7
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
