Difference between revisions of "RXN-16067"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1063 CPD0-1063] == * smiles: ** C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O) * in...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-THR-tRNAs Charged-THR-tRNAs] == * common name: ** an L-threonyl-[tRNAthr] * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1063 CPD0-1063] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-THR-tRNAs Charged-THR-tRNAs] ==
* smiles:
+
** C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)
+
* inchi key:
+
** InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K
+
 
* common name:
 
* common name:
** 2-O-(6-phospho-α-D-mannosyl)-D-glycerate
+
** an L-threonyl-[tRNAthr]
* molecular weight:
+
** 345.176   
+
 
* Synonym(s):
 
* Synonym(s):
** 2(α-D-mannosyl-6-phosphate)-D-glycerate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5216]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an L-threonyl-[tRNAthr]}}
** [http://www.genome.jp/dbget-bin/www_bget?C16699 C16699]
+
{{#set: produced by=THREONINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60331 60331]
+
* BIGG : man6pglyc
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906104 46906104]
+
* HMDB : HMDB12152
+
{{#set: smiles=C(O)C(C(=O)[O-])OC1(OC(COP(=O)([O-])[O-])C(C(C1O)O)O)}}
+
{{#set: inchi key=InChIKey=BOLXAGHGKNGVBE-MTXRGOKVSA-K}}
+
{{#set: common name=2-O-(6-phospho-α-D-mannosyl)-D-glycerate}}
+
{{#set: molecular weight=345.176    }}
+
{{#set: common name=2(α-D-mannosyl-6-phosphate)-D-glycerate}}
+
{{#set: consumed by=RXN0-5216}}
+

Revision as of 12:05, 18 January 2018

Metabolite Charged-THR-tRNAs

  • common name:
    • an L-threonyl-[tRNAthr]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-threonyl-[tRNAthr" cannot be used as a page name in this wiki.