Difference between revisions of "CHC T00008765001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6606 PWY-6606] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6606 PWY-6606] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** guanosine nucleotides degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''2''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN-7609]] |
− | + | ** [[RXN0-901]] | |
+ | == Reaction(s) not found == | ||
+ | * '''2''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-366 RXN0-366] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=GUANINE-DEAMINASE-RXN GUANINE-DEAMINASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: common name=guanosine nucleotides degradation II}} | |
− | + | {{#set: reaction found=2}} | |
− | {{#set: | + | {{#set: reaction not found=2}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:05, 18 January 2018
Pathway PWY-6606
Reaction(s) found
Reaction(s) not found
- 2 reaction(s) not found