Difference between revisions of "GMP-SYN-NH3-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7229 CPD-7229] == * smiles: ** C(C2(OC(N1(C=C(CC=C1)C(=O)N))C(C(O)2)O))O * common name: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5.1.2.3-RXN 5.1.2.3-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5.1.2.3-RXN 5.1.2.3-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** 1- | + | ** [http://enzyme.expasy.org/EC/5.1.2.3 EC-5.1.2.3] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | = | + | ** 1 [[S-3-HYDROXYBUTANOYL-COA]][c] '''<=>''' 1 [[CPD-650]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 (S)-3-hydroxybutanoyl-CoA[c] '''<=>''' 1 (3R)-3-hydroxybutanoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00009422001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[CHC_T00009349001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21760 21760] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03276 R03276] | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: direction=REVERSIBLE}} |
− | * LIGAND- | + | {{#set: ec number=EC-5.1.2.3}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=CHC_T00009422001_1|CHC_T00009349001_1}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=galdieria.sulphuraria}} |
− | {{#set: | + |
Revision as of 11:05, 18 January 2018
Contents
Reaction 5.1.2.3-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-3-HYDROXYBUTANOYL-COA[c] <=> 1 CPD-650[c]
- With common name(s):
- 1 (S)-3-hydroxybutanoyl-CoA[c] <=> 1 (3R)-3-hydroxybutanoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links