Difference between revisions of "RXN0-5408"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Gene == Gene CHC_T00008848001_1 == * Synonym(s): == Reactions associated == * 3.2.1.113-RXN ** pantograph-galdieria.sulphuraria == Pathways associate...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008848001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.2.1.113-RXN]] |
− | + | ** [[pantograph]]-[[galdieria.sulphuraria]] | |
− | + | == Pathways associated == | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.2.1.113-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 12:06, 18 January 2018
Gene CHC_T00008848001_1
- Synonym(s):