Difference between revisions of "CHD-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6524 PWY-6524] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-35...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6524 PWY-6524] ==
* smiles:
+
* taxonomic range:
** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-3568]
* inchi key:
+
** InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J
+
 
* common name:
 
* common name:
** OPC6-3-ketoacyl-CoA
+
** lychnose and isolychnose biosynthesis
* molecular weight:
+
** 1025.85   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-10700]]
+
* '''1''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[2.4.1.82-RXN]]
* [[RXN-10702]]
+
== Reaction(s) not found ==
== Reaction(s) of unknown directionality ==
+
* '''3''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.123-RXN 2.4.1.123-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-15224 RXN-15224]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11490 RXN-11490]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3568}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237277 44237277]
+
{{#set: common name=lychnose and isolychnose biosynthesis}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: reaction found=1}}
{{#set: inchi key=InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J}}
+
{{#set: reaction not found=3}}
{{#set: common name=OPC6-3-ketoacyl-CoA}}
+
{{#set: molecular weight=1025.85    }}
+
{{#set: consumed by=RXN-10700}}
+
{{#set: produced by=RXN-10702}}
+

Revision as of 11:07, 18 January 2018

Pathway PWY-6524

  • taxonomic range:
  • common name:
    • lychnose and isolychnose biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links