Difference between revisions of "CPD-597"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-823 PWY1F-823] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-823 PWY1F-823] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** leucopelargonidin and leucocyanidin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''2''' reaction(s) found |
− | * [[ | + | ** [[RXN-600]] |
− | == Reaction(s) | + | ** [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
− | + | == Reaction(s) not found == | |
+ | * '''2''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-525 RXN-525] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7775 RXN-7775] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY1F-823 PWY1F-823] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-58024}} |
− | + | {{#set: common name=leucopelargonidin and leucocyanidin biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: reaction not found=2}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:07, 18 January 2018
Pathway PWY1F-823
- taxonomic range:
- common name:
- leucopelargonidin and leucocyanidin biosynthesis
- Synonym(s):
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
External links
- ARACYC: