Difference between revisions of "CHC T00000383001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] == * smiles: ** C[N+](C)(C[CH]=O)C * inchi key: ** InChIKey=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE_ALDEHYDE BETAINE_ALDEHYDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537] ==
−
* smiles:
+
* taxonomic range:
−
** C[N+](C)(C[CH]=O)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
−
** InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** betaine aldehyde
+
** pyruvate fermentation to acetate V
−
* molecular weight:
+
−
** 102.156   
+
 
* Synonym(s):
 
* Synonym(s):
−
** glycine betaine aldehyde
+
** acetate fermentation
−
** N,N,N-trimethyl-2-oxoethylammonium
+
** acetate:succinate CoA transferase/SCoAS cycle
 +
** ASCT cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''2''' reaction(s) found
−
* [[RXN0-7230]]
+
** [[PYRUVDEH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[SUCCCOASYN-RXN]]
−
* [[BADH-RXN]]
+
== Reaction(s) not found ==
−
* [[CHD-RXN]]
+
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=PWY-5536 PWY-5536]
 
== External links  ==
 
== External links  ==
−
* CAS : 7418-61-3
+
{{#set: taxonomic range=TAX-33682}}
−
* METABOLIGHTS : MTBLC15710
+
{{#set: taxonomic range=TAX-33154}}
−
* DRUGBANK : DB04401
+
{{#set: common name=pyruvate fermentation to acetate V}}
−
* PUBCHEM:
+
{{#set: common name=acetate fermentation|acetate:succinate CoA transferase/SCoAS cycle|ASCT cycle}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=249 249]
+
{{#set: reaction found=2}}
−
* HMDB : HMDB01252
+
{{#set: reaction not found=1}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00576 C00576]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.244.html 244]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15710 15710]
+
−
* BIGG : betald
+
−
{{#set: smiles=C[N+](C)(C[CH]=O)C}}
+
−
{{#set: inchi key=InChIKey=SXKNCCSPZDCRFD-UHFFFAOYSA-N}}
+
−
{{#set: common name=betaine aldehyde}}
+
−
{{#set: molecular weight=102.156    }}
+
−
{{#set: common name=glycine betaine aldehyde|N,N,N-trimethyl-2-oxoethylammonium}}
+
−
{{#set: produced by=RXN0-7230}}
+
−
{{#set: consumed or produced by=BADH-RXN|CHD-RXN}}
+

Revision as of 11:07, 18 January 2018

Pathway PWY-5537

  • taxonomic range:
  • common name:
    • pyruvate fermentation to acetate V
  • Synonym(s):
    • acetate fermentation
    • acetate:succinate CoA transferase/SCoAS cycle
    • ASCT cycle

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00000383001_1&oldid=6522"