Difference between revisions of "PWY-6976"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNAs-With-PolyA-Tails mRNAs-With-PolyA-Tails] == * common name: ** a mRNA with poly(A) tail *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) | ||
| + | * inchi key: | ||
| + | ** InChIKey=DJJCXFVJDGTHFX-XVFCMESISA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** UMP |
| + | * molecular weight: | ||
| + | ** 322.168 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** uridylate | ||
| + | ** 5'-UMP | ||
| + | ** uridine 5'-phosphate | ||
| + | ** 5'-uridylic acid (8CI)(9CI) | ||
| + | ** uridine monophosphate | ||
| + | ** uridine 5'-monophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14025]] |
| + | * [[RXN-12002]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[OROTPDECARB-RXN]] | ||
| + | * [[2.7.8.15-RXN]] | ||
| + | * [[RXN-14139]] | ||
| + | * [[RXN-12197]] | ||
| + | * [[RXN-12199]] | ||
| + | * [[URACIL-PRIBOSYLTRANS-RXN]] | ||
| + | * [[URIDINEKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[URKI-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 58-97-9 |
| − | {{#set: consumed by= | + | * METABOLIGHTS : MTBLC57865 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1778309 1778309] | ||
| + | * HMDB : HMDB00288 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00105 C00105] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.1399139.html 1399139] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57865 57865] | ||
| + | * BIGG : ump | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))}} | ||
| + | {{#set: inchi key=InChIKey=DJJCXFVJDGTHFX-XVFCMESISA-L}} | ||
| + | {{#set: common name=UMP}} | ||
| + | {{#set: molecular weight=322.168 }} | ||
| + | {{#set: common name=uridylate|5'-UMP|uridine 5'-phosphate|5'-uridylic acid (8CI)(9CI)|uridine monophosphate|uridine 5'-monophosphate}} | ||
| + | {{#set: consumed by=RXN-14025|RXN-12002}} | ||
| + | {{#set: produced by=OROTPDECARB-RXN|2.7.8.15-RXN|RXN-14139|RXN-12197|RXN-12199|URACIL-PRIBOSYLTRANS-RXN|URIDINEKIN-RXN}} | ||
| + | {{#set: consumed or produced by=URKI-RXN}} | ||
Revision as of 11:07, 18 January 2018
Contents
Metabolite UMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))
- inchi key:
- InChIKey=DJJCXFVJDGTHFX-XVFCMESISA-L
- common name:
- UMP
- molecular weight:
- 322.168
- Synonym(s):
- uridylate
- 5'-UMP
- uridine 5'-phosphate
- 5'-uridylic acid (8CI)(9CI)
- uridine monophosphate
- uridine 5'-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 58-97-9
- METABOLIGHTS : MTBLC57865
- PUBCHEM:
- HMDB : HMDB00288
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : ump
"C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.
