Difference between revisions of "RXN-17781"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00005094001_1 == * Synonym(s): == Reactions associated == * 2.5.1.46-RXN ** pantograph-galdieria.sulphuraria * RXN-13414 ** p...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00005094001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * [[2.5.1.46-RXN]] |
| − | * [[RXN- | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
| − | * [[ | + | * [[RXN-13414]] |
| − | * [[RXN- | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
| − | + | * [[RXN-13415]] | |
| − | * [[RXN- | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
| − | * [[ | + | * [[RXN-13416]] |
| − | * [[RXN- | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
| − | == | + | * [[RXN-13417]] |
| + | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-5905]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=2.5.1.46-RXN|RXN-13414|RXN-13415|RXN-13416|RXN-13417}} | |
| − | + | {{#set: pathway associated=PWY-5905}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 11:08, 18 January 2018
Gene CHC_T00005094001_1
- Synonym(s):
