Difference between revisions of "CHC T00009504001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00008680001_1 == * Synonym(s): == Reactions associated == * METHENYLTHFCYCLOHYDRO-RXN ** pantograph-galdieria.sulphuraria * METHY...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008680001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[METHENYLTHFCYCLOHYDRO-RXN]] |
− | + | ** [[pantograph]]-[[galdieria.sulphuraria]] | |
− | * [[ | + | * [[METHYLENETHFDEHYDROG-NADP-RXN]] |
− | == | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
+ | == Pathways associated == | ||
+ | * [[PWY-1722]] | ||
+ | * [[PWY-3841]] | ||
+ | * [[1CMET2-PWY]] | ||
+ | * [[PWY-5030]] | ||
+ | * [[P164-PWY]] | ||
+ | * [[CODH-PWY]] | ||
+ | * [[PWY-5497]] | ||
+ | * [[PWY-2201]] | ||
+ | * [[PWY-6613]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=METHENYLTHFCYCLOHYDRO-RXN|METHYLENETHFDEHYDROG-NADP-RXN}} | |
− | + | {{#set: pathway associated=PWY-1722|PWY-3841|1CMET2-PWY|PWY-5030|P164-PWY|CODH-PWY|PWY-5497|PWY-2201|PWY-6613}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 12:08, 18 January 2018
Gene CHC_T00008680001_1
- Synonym(s):