Difference between revisions of "CPD-12829"

Revision as of 12:08, 18 January 2018

"CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.

"4-hydroxy-2-nonenal-[L-Cys] conjugate" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Pathway]]
+[[Category:Metabolite]]
-== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6759 PWY-6759] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
-* taxonomic range:
+* smiles:
-** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
-** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+* inchi key:
+** InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
 * common name:
-** hydrogen production III
+** 4-hydroxy-2-nonenal-[L-Cys] conjugate
+* molecular weight:
+** 277.378
 * Synonym(s):
-== Reaction(s) found ==
+== Reaction(s) known to consume the compound ==
-* '''1''' reaction(s) found
+== Reaction(s) known to produce the compound ==
-** [[HYDROG-RXN]]
+* [[RXN-13677]]
-== Reaction(s) not found ==
+== Reaction(s) of unknown directionality ==
-* '''0''' reaction(s) not found
 == External links  ==
-{{#set: taxonomic range=TAX-2}}
+* PUBCHEM:
-{{#set: taxonomic range=TAX-2157}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657989 90657989]
-{{#set: common name=hydrogen production III}}
+{{#set: smiles=CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]}}
-{{#set: reaction found=1}}
+{{#set: inchi key=InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N}}
-{{#set: reaction not found=0}}
+{{#set: common name=4-hydroxy-2-nonenal-[L-Cys] conjugate}}
+{{#set: molecular weight=277.378    }}
+{{#set: produced by=RXN-13677}}