Difference between revisions of "CHC T00008868001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
 
(Created page with "Category:Gene == Gene CHC_T00009299001 == * left end position: ** 95647 * transcription direction: ** NEGATIVE * right end position: ** 96918 * centisome position: ** 40.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
+
== Gene CHC_T00009299001 ==
−
* smiles:
+
* left end position:
−
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
+
** 95647
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-enolpyruvoyl-shikimate 3-phosphate
+
** 96918
−
* molecular weight:
+
* centisome position:
−
** 320.149    
+
** 40.43604    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-enolpyruvyl-shikimate 5-phosphate
 
−
** 3-enolpyruvyl-shikimate-5-P
 
−
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
 
−
** 5-enolpyruvyl-shikimate 3-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[CHORISMATE-SYNTHASE-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** original_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
−
* [[2.5.1.19-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=95647}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=96918}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
+
{{#set: centisome position=40.43604   }}
−
* BIGG : 3psme
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
+
−
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
+
−
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
+
−
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
+
−
{{#set: molecular weight=320.149   }}
+
−
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
+
−
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
+
−
{{#set: consumed or produced by=2.5.1.19-RXN}}
+

Revision as of 12:09, 18 January 2018

Gene CHC_T00009299001

  • left end position:
    • 95647
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 96918
  • centisome position:
    • 40.43604
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008868001&oldid=6627"