Difference between revisions of "PWY-6320"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
(Created page with "Category:Gene == Gene CHC_T00009531001 == * left end position: ** 171786 * transcription direction: ** NEGATIVE * right end position: ** 173804 * centisome position: ** 26...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009531001 == |
− | * | + | * left end position: |
− | ** | + | ** 171786 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 173804 |
− | * | + | * centisome position: |
− | ** | + | ** 26.294554 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ACYL-COA-OXIDASE-RXN]] | |
− | * [[RXN- | + | ** original_genome |
− | * [[RXN- | + | ***automated-name-match |
− | * [[RXN- | + | * [[RXN-10696]] |
− | * [[RXN- | + | ** original_genome |
− | == | + | ***automated-name-match |
+ | * [[RXN-10706]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-10707]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-11026]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-12518]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-12669]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-14576]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-14771]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-14775]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-14785]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-14789]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-14796]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-16134]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-17113]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6920]] | ||
+ | * [[PWY-7340]] | ||
+ | * [[PWY-7291]] | ||
+ | * [[PWY-735]] | ||
+ | * [[PWY-7606]] | ||
+ | * [[PWY-7338]] | ||
+ | * [[PWY-6837]] | ||
+ | * [[PWY66-391]] | ||
+ | * [[PWY-5136]] | ||
+ | * [[PWY-7007]] | ||
+ | * [[PWY-7337]] | ||
+ | * [[PWY-7288]] | ||
+ | * [[PWY-7726]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=171786}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=173804}} | |
− | + | {{#set: centisome position=26.294554 }} | |
− | + | {{#set: reaction associated=ACYL-COA-OXIDASE-RXN|RXN-10696|RXN-10706|RXN-10707|RXN-11026|RXN-12518|RXN-12669|RXN-14576|RXN-14771|RXN-14775|RXN-14785|RXN-14789|RXN-14796|RXN-16134|RXN-17113}} | |
− | + | {{#set: pathway associated=PWY-6920|PWY-7340|PWY-7291|PWY-735|PWY-7606|PWY-7338|PWY-6837|PWY66-391|PWY-5136|PWY-7007|PWY-7337|PWY-7288|PWY-7726}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:09, 18 January 2018
Gene CHC_T00009531001
- left end position:
- 171786
- transcription direction:
- NEGATIVE
- right end position:
- 173804
- centisome position:
- 26.294554
- Synonym(s):
Reactions associated
- ACYL-COA-OXIDASE-RXN
- original_genome
- automated-name-match
- original_genome
- RXN-10696
- original_genome
- automated-name-match
- original_genome
- RXN-10706
- original_genome
- automated-name-match
- original_genome
- RXN-10707
- original_genome
- automated-name-match
- original_genome
- RXN-11026
- original_genome
- automated-name-match
- original_genome
- RXN-12518
- original_genome
- automated-name-match
- original_genome
- RXN-12669
- original_genome
- automated-name-match
- original_genome
- RXN-14576
- original_genome
- automated-name-match
- original_genome
- RXN-14771
- original_genome
- automated-name-match
- original_genome
- RXN-14775
- original_genome
- automated-name-match
- original_genome
- RXN-14785
- original_genome
- automated-name-match
- original_genome
- RXN-14789
- original_genome
- automated-name-match
- original_genome
- RXN-14796
- original_genome
- automated-name-match
- original_genome
- RXN-16134
- original_genome
- automated-name-match
- original_genome
- RXN-17113
- original_genome
- automated-name-match
- original_genome
Pathways associated
- PWY-6920
- PWY-7340
- PWY-7291
- PWY-735
- PWY-7606
- PWY-7338
- PWY-6837
- PWY66-391
- PWY-5136
- PWY-7007
- PWY-7337
- PWY-7288
- PWY-7726