|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMINESYN-RXN GLUTAMINESYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/6.3.1.2 EC-6.3.1.2] | + | ** InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J |
| + | * common name: |
| + | ** (2E)-5-methylhexa-2,4-dienoyl-CoA |
| + | * molecular weight: |
| + | ** 871.642 |
| * Synonym(s): | | * Synonym(s): |
− | ** type I glutamate--ammonia ligase
| |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-11919]] |
− | ** 1 [[GLT]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GLN]][c] '''+''' 1 [[ADP]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 L-glutamate[c] '''+''' 1 ATP[c] '''+''' 1 ammonium[c] '''=>''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 L-glutamine[c] '''+''' 1 ADP[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00010135001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[CHC_T00005451001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | * [[CHC_T00005454001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | == Pathways == | + | |
− | * [[GLNSYN-PWY]], L-glutamine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLNSYN-PWY GLNSYN-PWY]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY-5675]], nitrate reduction V (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5675 PWY-5675]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-381]], nitrate reduction II (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
| + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-6964]], ammonia assimilation cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6964 PWY-6964]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY490-3]], nitrate reduction VI (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3]
| + | |
− | ** '''3''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6963]], ammonia assimilation cycle I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6963 PWY-6963]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
− | *** [[a.taliana]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16169 16169] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986176 50986176] |
− | * LIGAND-RXN: | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00253 R00253] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16468 C16468] |
− | * UNIPROT:
| + | {{#set: smiles=CC(C)=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://www.uniprot.org/uniprot/P15103 P15103]
| + | {{#set: inchi key=InChIKey=IFMYVRQEHQTINS-MEOYLLPMSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P15124 P15124]
| + | {{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P15623 P15623]
| + | {{#set: molecular weight=871.642 }} |
− | ** [http://www.uniprot.org/uniprot/P21154 P21154]
| + | {{#set: consumed by=RXN-11919}} |
− | ** [http://www.uniprot.org/uniprot/P45627 P45627]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59982 Q59982]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M314 Q7M314]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60182 Q60182]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04078 P04078]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00964 P00964]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22248 P22248]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07804 P07804]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13564 P13564]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12425 P12425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19064 P19064]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16580 P16580]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10656 P10656]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11600 P11600]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A1P6 P0A1P6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9C5 P0A9C5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00965 P00965]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04771 P04771]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04770 P04770]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15102 P15102]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10583 P10583]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23712 P23712]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15105 P15105]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08282 P08282]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08281 P08281]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07694 P07694]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09606 P09606]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14654 P14654]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14655 P14655]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14656 P14656]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22878 P22878]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19432 P19432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15106 P15106]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19904 P19904]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14636 P14636]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04772 P04772]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09826 P09826]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05457 P05457]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JSU6 Q9JSU6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PPK8 Q9PPK8]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66514 O66514]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8X7G0 Q8X7G0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CDL9 Q9CDL9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05650 Q05650]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43794 P43794]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31592 P31592]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27747 Q27747]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12424 P12424]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04831 Q04831]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24099 P24099]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04998 O04998]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04999 O04999]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20479 P20479]
| + | |
− | ** [http://www.uniprot.org/uniprot/O75014 O75014]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23794 P23794]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43127 Q43127]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9FHR0 Q9FHR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9C8C7 Q9C8C7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28786 P28786]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02154 Q02154]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05542 Q05542]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42624 Q42624]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43518 P43518]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52783 P52783]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43759 Q43759]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38559 P38559]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38560 P38560]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38561 P38561]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38562 P38562]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38563 P38563]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25462 P25462]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42625 Q42625]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46410 P46410]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42802 Q42802]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42623 Q42623]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q53045 Q53045]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32288 P32288]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43066 Q43066]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59195 Q59195]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51118 P51118]
| + | |
− | ** [http://www.uniprot.org/uniprot/P51119 P51119]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42950 Q42950]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42951 Q42951]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q07939 Q07939]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43760 Q43760]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42688 Q42688]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42689 Q42689]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22504 O22504]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22505 O22505]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22506 O22506]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59972 Q59972]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UWN1 Q9UWN1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RDW7 Q9RDW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43386 P43386]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A040 P0A040]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: ec number=EC-6.3.1.2}} | + | |
− | {{#set: common name=type I glutamate--ammonia ligase}} | + | |
− | {{#set: gene associated=CHC_T00010135001_1|CHC_T00005451001_1|CHC_T00005454001_1}}
| + | |
− | {{#set: in pathway=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY490-3|PWY-6963}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
| + | |