Difference between revisions of "CHC T00010194001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/3.4.11.2 EC-3.4.11.2] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-6262]][c] '''=>''' 1 [[GLY]][c] '''+''' 1 [[S-Substituted-L-Cysteines]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 a [Cys-Gly]-S-conjugate[c] '''=>''' 1 glycine[c] '''+''' 1 an L-cysteine-S-conjugate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[CHC_T00002549001_1]] | ||
| + | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6842]], glutathione-mediated detoxification II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6842 PWY-6842] | ||
| + | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
| + | * [[PWY-4061]], glutathione-mediated detoxification I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061] | ||
| + | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-3.4.11.2}} | |
| − | + | {{#set: gene associated=CHC_T00002549001_1}} | |
| − | + | {{#set: in pathway=PWY-6842|PWY-4061}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=galdieria.sulphuraria}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 11:10, 18 January 2018
Contents
Reaction RXN-6642
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-6262[c] => 1 GLY[c] + 1 S-Substituted-L-Cysteines[c]
- With common name(s):
- 1 H2O[c] + 1 a [Cys-Gly]-S-conjugate[c] => 1 glycine[c] + 1 an L-cysteine-S-conjugate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6842, glutathione-mediated detoxification II: PWY-6842
- 2 reactions found over 8 reactions in the full pathway
- PWY-4061, glutathione-mediated detoxification I: PWY-4061
- 2 reactions found over 5 reactions in the full pathway
