Difference between revisions of "QXC-ACP"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_840 == * left end position: ** 128273 * transcription direction: ** POSITIVE * right end position: ** 128827 * common name: ** atpD * centisome p...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == * smiles: ** C(C1(C(C(C(O1)(COP(=O)([O-])[O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** fructose 1,6-bisphosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 336.085 |
* Synonym(s): | * Synonym(s): | ||
| + | ** fructose 1,6-biphosphate | ||
| + | ** fructose 1,6-diphosphate | ||
| + | ** β-D-fructose 1,6-diphosphate | ||
| + | ** D-fructose 1,6-diphosphate | ||
| + | ** D-fructos 1,6-bisphosphate | ||
| + | ** fructose 1,6-bisphosphate | ||
| + | ** FBP | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[F16BDEPHOS-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[6PFRUCTPHOS-RXN]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | * [[2.7.1.90-RXN]] |
| + | * [[F16ALDOLASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 488-69-7 |
| − | {{#set: | + | * Wikipedia : Fructose_1,6-bisphosphate |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460765 5460765] |
| − | {{#set: | + | * HMDB : HMDB01058 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00354 C00354] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4574223.html 4574223] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32966 32966] | ||
| + | * BIGG : fdp | ||
| + | {{#set: smiles=C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J}} | ||
| + | {{#set: common name=fructose 1,6-bisphosphate}} | ||
| + | {{#set: molecular weight=336.085 }} | ||
| + | {{#set: common name=fructose 1,6-biphosphate|fructose 1,6-diphosphate|β-D-fructose 1,6-diphosphate|D-fructose 1,6-diphosphate|D-fructos 1,6-bisphosphate|fructose 1,6-bisphosphate|FBP}} | ||
| + | {{#set: consumed by=F16BDEPHOS-RXN}} | ||
| + | {{#set: produced by=6PFRUCTPHOS-RXN}} | ||
| + | {{#set: consumed or produced by=2.7.1.90-RXN|F16ALDOLASE-RXN}} | ||
Revision as of 11:10, 18 January 2018
Contents
Metabolite FRUCTOSE-16-DIPHOSPHATE
- smiles:
- C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]
- inchi key:
- InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J
- common name:
- fructose 1,6-bisphosphate
- molecular weight:
- 336.085
- Synonym(s):
- fructose 1,6-biphosphate
- fructose 1,6-diphosphate
- β-D-fructose 1,6-diphosphate
- D-fructose 1,6-diphosphate
- D-fructos 1,6-bisphosphate
- fructose 1,6-bisphosphate
- FBP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 488-69-7
- Wikipedia : Fructose_1,6-bisphosphate
- PUBCHEM:
- HMDB : HMDB01058
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : fdp
"C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-" cannot be used as a page name in this wiki.
