Difference between revisions of "PWY-5046"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Tyrosines Protein-Tyrosines] == * common name: ** a [protein]-L-tyrosine * Synonym(s):...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Tyrosines Protein-Tyrosines] ==
* smiles:
+
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=KYBJQEICWVEWIL-TUUMQRACSA-M
+
 
* common name:
 
* common name:
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
+
** a [protein]-L-tyrosine
* molecular weight:
+
** 643.968   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-methoxy-4-hydroxy-5-heptaprenylbenzoate
+
** a protein tyrosine
** 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid
+
** protein tyrosine
** 3-heptaprenyl-4-hydroxy-5-methoxybenzoate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.10.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9287]]
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-L-tyrosine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54746223 54746223]
+
{{#set: common name=a protein tyrosine|protein tyrosine}}
* CHEBI:
+
{{#set: consumed by=2.7.10.1-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84454 84454]
+
{{#set: produced by=PROTEIN-TYROSINE-PHOSPHATASE-RXN}}
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=KYBJQEICWVEWIL-TUUMQRACSA-M}}
+
{{#set: common name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: molecular weight=643.968    }}
+
{{#set: common name=3-methoxy-4-hydroxy-5-heptaprenylbenzoate|3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-heptaprenyl-4-hydroxy-5-methoxybenzoate}}
+
{{#set: produced by=RXN-9287}}
+

Revision as of 11:10, 18 January 2018

Metabolite Protein-Tyrosines

  • common name:
    • a [protein]-L-tyrosine
  • Synonym(s):
    • a protein tyrosine
    • protein tyrosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-L-tyrosine" cannot be used as a page name in this wiki.