Difference between revisions of "TransportSeed CL-"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7155 PWY-7155] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-30...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7155 PWY-7155] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 7-dehydroporiferasterol biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''3''' reaction(s) found |
− | + | ** [[CYCLOARTENOL-SYNTHASE-RXN]] | |
− | * [[RXN- | + | ** [[RXN-13892]] |
− | * [[ | + | ** [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]] |
− | == Reaction(s) | + | == Reaction(s) not found == |
− | * [[ | + | * '''7''' reaction(s) not found |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13895 RXN-13895] |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13894 RXN-13894] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13897 RXN-13897] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13896 RXN-13896] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13891 RXN-13891] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13893 RXN-13893] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-4021 RXN-4021] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3041}} | |
− | + | {{#set: common name=7-dehydroporiferasterol biosynthesis}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=7}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 11:11, 18 January 2018
Pathway PWY-7155
- taxonomic range:
- common name:
- 7-dehydroporiferasterol biosynthesis
- Synonym(s):
Reaction(s) found
- 3 reaction(s) found