Difference between revisions of "PWY-7411"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-epi-valiolone |
| + | * molecular weight: | ||
| + | ** 192.168 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17373]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=2-epi-valiolone}} |
| − | {{#set: | + | {{#set: molecular weight=192.168 }} |
| − | {{#set: | + | {{#set: common name=(2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}} |
| − | {{#set: | + | {{#set: produced by=RXN-17373}} |
Revision as of 11:12, 18 January 2018
Contents
Metabolite CPD-18780
- smiles:
- C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
- inchi key:
- InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N
- common name:
- 2-epi-valiolone
- molecular weight:
- 192.168
- Synonym(s):
- (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one
