Difference between revisions of "CHC T00010280001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == * smiles: ** CC1(N=CC(COP...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYL-PYR-P AMINO-HYDROXYMETHYL-METHYL-PYR-P] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L |
* common name: | * common name: | ||
− | ** | + | ** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 217.121 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-amino-5-phosphomethyl-2-methylpyrimidine | ||
+ | ** HMP-P | ||
+ | ** 4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PYRIMSYN3-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244846 25244846] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58354 58354] |
− | {{#set: smiles | + | * BIGG : 4ampm |
− | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04556 C04556] |
− | {{#set: molecular weight= | + | {{#set: smiles=CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L}} |
− | {{#set: | + | {{#set: common name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}} |
+ | {{#set: molecular weight=217.121 }} | ||
+ | {{#set: common name=4-amino-5-phosphomethyl-2-methylpyrimidine|HMP-P|4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate}} | ||
+ | {{#set: consumed by=PYRIMSYN3-RXN}} |
Revision as of 11:12, 18 January 2018
Contents
Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P
- smiles:
- CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)
- inchi key:
- InChIKey=PKYFHKIYHBRTPI-UHFFFAOYSA-L
- common name:
- 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
- molecular weight:
- 217.121
- Synonym(s):
- 4-amino-5-phosphomethyl-2-methylpyrimidine
- HMP-P
- 4-amino-5-hydroxymethyl-2-methylpyrimidine-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(N=CC(COP(=O)([O-])[O-])=C(N=1)N)" cannot be used as a page name in this wiki.