Difference between revisions of "PWY-6982"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE SUCROSE] == * smiles: ** C(C2(OC(OC1(OC(CO)C(C(O)1)O)CO)C(C(O)C2O)O))O * inchi key: **...") |
(Created page with "Category:Gene == Gene CHC_120 == * left end position: ** 15562 * transcription direction: ** POSITIVE * right end position: ** 17043 * common name: ** rne * centisome posi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_120 == |
− | * | + | * left end position: |
− | ** | + | ** 15562 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
+ | * right end position: | ||
+ | ** 17043 | ||
* common name: | * common name: | ||
− | ** | + | ** rne |
− | * | + | * centisome position: |
− | ** | + | ** 8.641427 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.1.26.12-RXN]] |
− | * [[ | + | ** original_genome |
− | + | ***automated-name-match | |
− | * [[ | + | * [[RXN0-6478]] |
− | * [[ | + | ** original_genome |
− | == | + | ***automated-name-match |
+ | * [[RXN0-6485]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN0-6521]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN0-6522]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN0-6523]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-1479]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=15562}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=17043}} | |
− | + | {{#set: common name=rne}} | |
− | + | {{#set: centisome position=8.641427 }} | |
− | + | {{#set: reaction associated=3.1.26.12-RXN|RXN0-6478|RXN0-6485|RXN0-6521|RXN0-6522|RXN0-6523}} | |
− | + | {{#set: pathway associated=PWY0-1479}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:12, 18 January 2018
Gene CHC_120
- left end position:
- 15562
- transcription direction:
- POSITIVE
- right end position:
- 17043
- common name:
- rne
- centisome position:
- 8.641427
- Synonym(s):
Reactions associated
- 3.1.26.12-RXN
- original_genome
- automated-name-match
- original_genome
- RXN0-6478
- original_genome
- automated-name-match
- original_genome
- RXN0-6485
- original_genome
- automated-name-match
- original_genome
- RXN0-6521
- original_genome
- automated-name-match
- original_genome
- RXN0-6522
- original_genome
- automated-name-match
- original_genome
- RXN0-6523
- original_genome
- automated-name-match
- original_genome