Difference between revisions of "PWY-2661"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] == * smiles: ** C(C1(C(C(C(O1)(COP(=O)([O-])[O...")
 
(Created page with "Category:Gene == Gene CHC_T00008987001 == * left end position: ** 205273 * transcription direction: ** POSITIVE * right end position: ** 206139 * centisome position: ** 48...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-16-DIPHOSPHATE FRUCTOSE-16-DIPHOSPHATE] ==
+
== Gene CHC_T00008987001 ==
−
* smiles:
+
* left end position:
−
** C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]
+
** 205273
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** fructose 1,6-bisphosphate
+
** 206139
−
* molecular weight:
+
* centisome position:
−
** 336.085    
+
** 48.246628    
 
* Synonym(s):
 
* Synonym(s):
−
** fructose 1,6-biphosphate
 
−
** fructose 1,6-diphosphate
 
−
** β-D-fructose 1,6-diphosphate
 
−
** D-fructose 1,6-diphosphate
 
−
** D-fructos 1,6-bisphosphate
 
−
** fructose 1,6-bisphosphate
 
−
** FBP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[F16BDEPHOS-RXN]]
+
* [[3.4.25.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** original_genome
−
* [[6PFRUCTPHOS-RXN]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[2.7.1.90-RXN]]
+
−
* [[F16ALDOLASE-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 488-69-7
+
{{#set: left end position=205273}}
−
* Wikipedia : Fructose_1,6-bisphosphate
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: right end position=206139}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460765 5460765]
+
{{#set: centisome position=48.246628   }}
−
* HMDB : HMDB01058
+
{{#set: reaction associated=3.4.25.1-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00354 C00354]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4574223.html 4574223]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32966 32966]
+
−
* BIGG : fdp
+
−
{{#set: smiles=C(C1(C(C(C(O1)(COP(=O)([O-])[O-])O)O)O))OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RNBGYGVWRKECFJ-ARQDHWQXSA-J}}
+
−
{{#set: common name=fructose 1,6-bisphosphate}}
+
−
{{#set: molecular weight=336.085   }}
+
−
{{#set: common name=fructose 1,6-biphosphate|fructose 1,6-diphosphate|β-D-fructose 1,6-diphosphate|D-fructose 1,6-diphosphate|D-fructos 1,6-bisphosphate|fructose 1,6-bisphosphate|FBP}}
+
−
{{#set: consumed by=F16BDEPHOS-RXN}}
+
−
{{#set: produced by=6PFRUCTPHOS-RXN}}
+
−
{{#set: consumed or produced by=2.7.1.90-RXN|F16ALDOLASE-RXN}}
+

Revision as of 11:12, 18 January 2018

Gene CHC_T00008987001

  • left end position:
    • 205273
  • transcription direction:
    • POSITIVE
  • right end position:
    • 206139
  • centisome position:
    • 48.246628
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-2661&oldid=6897"