Difference between revisions of "CHC 310"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7723 PWY-7723] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-267890 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == * smiles: ** [CH](=O)C(=O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=NZ...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10793 CPD-10793] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** [CH](=O)C(=O)COP(=O)([O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** hydroxypyruvaldehyde phosphate |
| + | * molecular weight: | ||
| + | ** 166.027 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2,3-dioxopropyl dihydrogen phosphate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-17808]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16849 C16849] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.19993665.html 19993665] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58860 58860] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21126161 21126161] | ||
| + | {{#set: smiles=[CH](=O)C(=O)COP(=O)([O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=hydroxypyruvaldehyde phosphate}} | ||
| + | {{#set: molecular weight=166.027 }} | ||
| + | {{#set: common name=2,3-dioxopropyl dihydrogen phosphate}} | ||
| + | {{#set: consumed by=RXN-17808}} | ||
Revision as of 11:13, 18 January 2018
Contents
Metabolite CPD-10793
- smiles:
- [CH](=O)C(=O)COP(=O)([O-])[O-]
- inchi key:
- InChIKey=NZAAQWRNVFEKME-UHFFFAOYSA-L
- common name:
- hydroxypyruvaldehyde phosphate
- molecular weight:
- 166.027
- Synonym(s):
- 2,3-dioxopropyl dihydrogen phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
