Difference between revisions of "CHC T00008935001"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008718001 == * left end position: ** 71399 * transcription direction: ** NEGATIVE * right end position: ** 72133 * centisome position: ** 67.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N |
− | * | + | * common name: |
− | ** | + | ** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol |
− | * | + | * molecular weight: |
− | ** | + | ** 442.724 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN66-13]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-12]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060] |
− | {{#set: | + | * HMDB : HMDB12159 |
− | {{#set: | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} |
+ | {{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}} | ||
+ | {{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}} | ||
+ | {{#set: molecular weight=442.724 }} | ||
+ | {{#set: consumed by=RXN66-13}} | ||
+ | {{#set: produced by=RXN66-12}} |
Revision as of 11:13, 18 January 2018
Contents
Metabolite CPD-8608
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- inchi key:
- InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
- common name:
- 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
- molecular weight:
- 442.724
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.