Difference between revisions of "SUMO-peptides"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Gene == Gene CHC_T00009287001_1 == * Synonym(s): == Reactions associated == * GSHTRAN-RXN ** pantograph-galdieria.sulphuraria ** pantograph-a.t...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009287001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[GSHTRAN-RXN]] | |
− | == | + | ** [[pantograph]]-[[galdieria.sulphuraria]] |
− | * [[ | + | ** [[pantograph]]-[[a.taliana]] |
+ | * [[GST-RXN]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[RXN-13673]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[RXN-15680]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7112]] | ||
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 12:14, 18 January 2018
Gene CHC_T00009287001_1
- Synonym(s):