Difference between revisions of "PWY-6583"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12587 RXN-12587] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.8...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12587 RXN-12587] ==
* smiles:
+
* direction:
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
* common name:
+
** cycloartenol
+
* molecular weight:
+
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
** 9β,19-cyclo-24-lanosten-3β-ol
 
** cycloart-24(25)-enol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
** 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''+''' 1 [[Unsulfurated-Sulfur-Acceptors]][c] '''<=>''' 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[Sulfurated-Sulfur-Acceptors]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''+''' 1 an unsulfurated [sulfur carrier][c] '''<=>''' 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 a sulfurated [sulfur carrier][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00000657001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00009510001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00008053001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
* CAS : 469-38-5
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: ec number=EC-2.8.1.7}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
{{#set: gene associated=CHC_T00000657001_1|CHC_T00009510001_1|CHC_T00008053001_1}}
* CHEBI:
+
{{#set: in pathway=}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
{{#set: reconstruction source=galdieria.sulphuraria}}
* HMDB : HMDB36591
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
{{#set: common name=cycloartenol}}
+
{{#set: molecular weight=426.724    }}
+
{{#set: common name=9&beta;,19-cyclo-24-lanosten-3&beta;-ol|cycloart-24(25)-enol}}
+
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Revision as of 11:14, 18 January 2018

Reaction RXN-12587

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links