Difference between revisions of "RXN-15680"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERRICYTOCHROME-B5 FERRICYTOCHROME-B5] == * common name: ** a ferricytochrome b5 * Synonym(s):...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERRICYTOCHROME-B5 FERRICYTOCHROME-B5] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a ferricytochrome b5 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an oxidized cytochrome b5 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CYTOCHROME-B5-REDUCTASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11887]] |
| + | * [[1.14.21.6-RXN]] | ||
| + | * [[RXN-13883]] | ||
| + | * [[RXN-4209]] | ||
| + | * [[RXN-13892]] | ||
| + | * [[RXN-10664]] | ||
| + | * [[RXN3O-218]] | ||
| + | * [[RXN-16332]] | ||
| + | * [[1.14.19.1-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-16378]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a ferricytochrome b5}} | |
| − | + | {{#set: common name=an oxidized cytochrome b5}} | |
| − | + | {{#set: consumed by=CYTOCHROME-B5-REDUCTASE-RXN}} | |
| − | + | {{#set: produced by=RXN-11887|1.14.21.6-RXN|RXN-13883|RXN-4209|RXN-13892|RXN-10664|RXN3O-218|RXN-16332|1.14.19.1-RXN}} | |
| − | + | {{#set: consumed or produced by=RXN-16378}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: produced by=RXN- | + | |
Revision as of 11:14, 18 January 2018
Contents
Metabolite FERRICYTOCHROME-B5
- common name:
- a ferricytochrome b5
- Synonym(s):
- an oxidized cytochrome b5
