Difference between revisions of "RXN66-313"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00010058001 == * left end position: ** 50466 * transcription direction: ** POSITIVE * right end position: ** 51689 * centisome position: ** 9.34...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9865 CPD-9865] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9865 CPD-9865] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N |
− | * | + | * common name: |
− | ** | + | ** 2-methoxy-6-(all-trans-decaprenyl)phenol |
− | * | + | * molecular weight: |
− | ** | + | ** 805.321 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9234]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25010760 25010760] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50774 50774] |
− | {{#set: | + | * METABOLIGHTS : MTBLC50774 |
− | {{#set: | + | * HMDB : HMDB60250 |
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N}} | ||
+ | {{#set: common name=2-methoxy-6-(all-trans-decaprenyl)phenol}} | ||
+ | {{#set: molecular weight=805.321 }} | ||
+ | {{#set: consumed by=RXN-9234}} |
Revision as of 11:16, 18 January 2018
Contents
Metabolite CPD-9865
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(OC)C=CC=1))C)C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=FYLLWSGFAAQKHU-GBBROCKZSA-N
- common name:
- 2-methoxy-6-(all-trans-decaprenyl)phenol
- molecular weight:
- 805.321
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links