Difference between revisions of "HEXADECANOL-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008908001 == * left end position: ** 580366 * transcription direction: ** POSITIVE * right end position: ** 583725 * centisome position: ** 88...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (R)-demethy...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008908001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] ==
* left end position:
+
* smiles:
** 580366
+
** C(O)C1(O)(CC(=O)C(O)=C(O)C1)
* transcription direction:
+
* common name:
** POSITIVE
+
** (R)-demethyl-4-deoxygadusol
* right end position:
+
* inchi key:
** 583725
+
** InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N
* centisome position:
+
* molecular weight:
** 88.83416    
+
** 174.153    
 
* Synonym(s):
 
* Synonym(s):
 +
** (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-7795]]
+
* [[RXN-17366]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-17372]]
* [[RXN3O-581]]
+
== Reaction(s) of unknown directionality ==
** original_genome
+
* [[RXN-17895]]
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-5129]]
+
* [[SPHINGOLIPID-SYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=580366}}
+
{{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}}
{{#set: transcription direction=POSITIVE}}
+
{{#set: common name=(R)-demethyl-4-deoxygadusol}}
{{#set: right end position=583725}}
+
{{#set: inchi key=InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N}}
{{#set: centisome position=88.83416   }}
+
{{#set: molecular weight=174.153   }}
{{#set: reaction associated=RXN-7795|RXN3O-581}}
+
{{#set: common name=(5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}}
{{#set: pathway associated=PWY-5129|SPHINGOLIPID-SYN-PWY}}
+
{{#set: consumed by=RXN-17366}}
 +
{{#set: produced by=RXN-17372}}
 +
{{#set: consumed or produced by=RXN-17895}}

Revision as of 11:17, 18 January 2018

Metabolite CPD-18773

  • smiles:
    • C(O)C1(O)(CC(=O)C(O)=C(O)C1)
  • common name:
    • (R)-demethyl-4-deoxygadusol
  • inchi key:
    • InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N
  • molecular weight:
    • 174.153
  • Synonym(s):
    • (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links