Difference between revisions of "HEXADECANOL-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008908001 == * left end position: ** 580366 * transcription direction: ** POSITIVE * right end position: ** 583725 * centisome position: ** 88...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (R)-demethy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) |
− | * | + | * common name: |
− | ** | + | ** (R)-demethyl-4-deoxygadusol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 174.153 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-17366]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17372]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | * [[RXN-17895]] | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}} |
− | {{#set: | + | {{#set: common name=(R)-demethyl-4-deoxygadusol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N}} |
− | {{#set: | + | {{#set: molecular weight=174.153 }} |
− | {{#set: | + | {{#set: common name=(5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}} |
− | {{#set: | + | {{#set: consumed by=RXN-17366}} |
+ | {{#set: produced by=RXN-17372}} | ||
+ | {{#set: consumed or produced by=RXN-17895}} |
Revision as of 12:17, 18 January 2018
Contents
Metabolite CPD-18773
- smiles:
- C(O)C1(O)(CC(=O)C(O)=C(O)C1)
- common name:
- (R)-demethyl-4-deoxygadusol
- inchi key:
- InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N
- molecular weight:
- 174.153
- Synonym(s):
- (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one