Difference between revisions of "CHC T00010056001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8616 RXN-8616] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/4....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8616 RXN-8616] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.3.48 EC-4.2.3.48] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[FARNESYL-PP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-12568]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 (2E,6E)-farnesyl diphosphate[c] '''+''' 1 H2O[c] '''=>''' 1 diphosphate[c] '''+''' 1 (3S,6E)-nerolidol[c] | |
− | * [[ | + | |
− | + | == Genes associated with this reaction == | |
− | == | + | == Pathways == |
− | + | * [[PWY-5434]], (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5434 PWY-5434] | |
− | * [[ | + | ** '''4''' reactions found over '''4''' reactions in the full pathway |
− | + | == Reconstruction information == | |
− | + | * [[gap-filling]]: | |
− | + | ** [[meneco]]: | |
− | * | + | *** [[added for gapfilling]] |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27530 27530] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08374 R08374] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-4.2.3.48}} |
− | + | {{#set: in pathway=PWY-5434}} | |
− | + | {{#set: reconstruction category=gap-filling}} | |
− | + | {{#set: reconstruction tool=meneco}} | |
− | {{#set: | + | {{#set: reconstruction source=added for gapfilling}} |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 12:17, 18 January 2018
Contents
Reaction RXN-8616
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FARNESYL-PP[c] + 1 WATER[c] => 1 PPI[c] + 1 CPD-12568[c]
- With common name(s):
- 1 (2E,6E)-farnesyl diphosphate[c] + 1 H2O[c] => 1 diphosphate[c] + 1 (3S,6E)-nerolidol[c]
Genes associated with this reaction
Pathways
- PWY-5434, (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis: PWY-5434
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
External links