Difference between revisions of "FUM"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2350 CPD0-2350] == * common name: ** a polycistronic tRNA precursor * Synonym(s): == Reac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == |
| + | * smiles: | ||
| + | ** C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** dUTP |
| + | * molecular weight: | ||
| + | ** 464.112 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** deoxy-UTP | ||
| + | ** 2'-deoxyuridine-5'-triphosphate | ||
| + | ** deoxyuridine-triphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DUTP-PYROP-RXN]] |
| − | * [[ | + | * [[RXN-14199]] |
| − | * [[ | + | * [[RXN-14219]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DUDPKIN-RXN]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 1173-82-6 |
| − | {{#set: consumed by= | + | * PUBCHEM: |
| − | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408] |
| + | * HMDB : HMDB01191 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] | ||
| + | * BIGG : dutp | ||
| + | {{#set: smiles=C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}} | ||
| + | {{#set: common name=dUTP}} | ||
| + | {{#set: molecular weight=464.112 }} | ||
| + | {{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} | ||
| + | {{#set: consumed by=DUTP-PYROP-RXN|RXN-14199|RXN-14219}} | ||
| + | {{#set: produced by=DUDPKIN-RXN}} | ||
Revision as of 11:18, 18 January 2018
Contents
Metabolite DUTP
- smiles:
- C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- inchi key:
- InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
- common name:
- dUTP
- molecular weight:
- 464.112
- Synonym(s):
- deoxy-UTP
- 2'-deoxyuridine-5'-triphosphate
- deoxyuridine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(NC(C=C1)=O)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
