Difference between revisions of "TransportSeed NITRATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7170 PWY-7170] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-30...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7170 PWY-7170] ==
* smiles:
+
* taxonomic range:
** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
** InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N
+
 
* common name:
 
* common name:
** 9,15,9'-tri-cis-ζ-carotene
+
** phytochromobilin biosynthesis
* molecular weight:
+
** 540.914   
+
 
* Synonym(s):
 
* Synonym(s):
** 9,15,9'-cis-ζ-carotene
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-11354]]
+
* '''1''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[1.3.7.4-RXN]]
* [[RXN-12244]]
+
== Reaction(s) not found ==
== Reaction(s) of unknown directionality ==
+
* '''2''' reaction(s) not found
* [[RXN-11355-CPD-12321/PLASTOQUINONE-9//CPD-7535/CPD-12829.46.]]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17523 RXN-17523]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13968 RXN-13968]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-3041}}
** [http://www.genome.jp/dbget-bin/www_bget?C19764 C19764]
+
{{#set: taxonomic range=TAX-33090}}
* CHEBI:
+
{{#set: common name=phytochromobilin biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48717 48717]
+
{{#set: reaction found=1}}
* PUBCHEM:
+
{{#set: reaction not found=2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24755586 24755586]
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N}}
+
{{#set: common name=9,15,9'-tri-cis-ζ-carotene}}
+
{{#set: molecular weight=540.914    }}
+
{{#set: common name=9,15,9'-cis-ζ-carotene}}
+
{{#set: consumed by=RXN-11354}}
+
{{#set: produced by=RXN-12244}}
+
{{#set: consumed or produced by=RXN-11355-CPD-12321/PLASTOQUINONE-9//CPD-7535/CPD-12829.46.}}
+

Revision as of 12:19, 18 January 2018

Pathway PWY-7170

  • taxonomic range:
  • common name:
    • phytochromobilin biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links