Difference between revisions of "CHC T00000829001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == * smiles: ** C=CC2(C(C)=C4(C=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14261 RXN-14261] == * direction: ** LEFT-TO-RIGHT * common name: ** Disproportionating Enzyme t...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14261 RXN-14261] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester
+
** Disproportionating Enzyme type 2
−
* molecular weight:
+
* ec number:
−
** 613.974   
+
** [http://enzyme.expasy.org/EC/2.4.1.25 EC-2.4.1.25]
 
* Synonym(s):
 
* Synonym(s):
−
** 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5283]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[MALTOPENTAOSE]][c] '''+''' 1 [[MALTOSE]][c] '''=>''' 1 [[MALTOHEXAOSE]][c] '''+''' 1 [[Glucopyranose]][c]
−
* [[RXN-5282]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 maltopentaose[c] '''+''' 1 maltose[c] '''=>''' 1 maltohexaose[c] '''+''' 1 D-glucopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009120001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[CHC_T00009120001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658233 90658233]
+
{{#set: common name=Disproportionating Enzyme type 2}}
−
* CHEBI:
+
{{#set: ec number=EC-2.4.1.25}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60489 60489]
+
{{#set: gene associated=CHC_T00009120001|CHC_T00009120001_1}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11829 C11829]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB02379
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: common name=131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=613.974    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester}}
+
{{#set: reconstruction source=original_genome}}
−
{{#set: consumed by=RXN-5283}}
+
−
{{#set: produced by=RXN-5282}}
+

Revision as of 11:19, 18 January 2018

Reaction RXN-14261

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Disproportionating Enzyme type 2
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00000829001_1&oldid=7552"