Difference between revisions of "TRANS-RXN1HP7-24"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00010097001 == * left end position: ** 253461 * transcription direction: ** POSITIVE * right end position: ** 254300 * centisome position: ** 86...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene CHC_T00010097001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] ==
−
* left end position:
+
* smiles:
−
** 253461
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
−
* right end position:
+
* common name:
−
** 254300
+
** ergosta-5,7-dienol
−
* centisome position:
+
* molecular weight:
−
** 86.65688    
+
** 398.671    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[1.11.1.15-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** original_genome
+
* [[RXN-13883]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[RXN0-5468]]
+
−
** original_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=253461}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5326970 5326970]
−
{{#set: right end position=254300}}
+
* CHEBI:
−
{{#set: centisome position=86.65688   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66918 66918]
−
{{#set: reaction associated=1.11.1.15-RXN|RXN0-5468}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N}}
 +
{{#set: common name=ergosta-5,7-dienol}}
 +
{{#set: molecular weight=398.671   }}
 +
{{#set: produced by=RXN-13883}}

Revision as of 11:19, 18 January 2018

Metabolite CPD-14894

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
  • common name:
    • ergosta-5,7-dienol
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=TRANS-RXN1HP7-24&oldid=7557"