Difference between revisions of "PWY-7388"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Gene == Gene CHC_T00010274001 == * left end position: ** 122491 * transcription direction: ** POSITIVE * right end position: ** 123222 * centisome position: ** 65...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00010274001 == |
− | * | + | * left end position: |
− | ** | + | ** 122491 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 123222 |
− | * | + | * centisome position: |
− | ** | + | ** 65.290924 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[FUMARYLACETOACETASE-RXN]] | |
− | * [[RXN | + | ** original_genome |
− | * | + | ***automated-name-match |
− | * [[ | + | == Pathways associated == |
− | + | * [[TYRFUMCAT-PWY]] | |
== External links == | == External links == | ||
− | + | {{#set: left end position=122491}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=123222}} | |
− | + | {{#set: centisome position=65.290924 }} | |
− | + | {{#set: reaction associated=FUMARYLACETOACETASE-RXN}} | |
− | + | {{#set: pathway associated=TYRFUMCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 12:20, 18 January 2018
Gene CHC_T00010274001
- left end position:
- 122491
- transcription direction:
- POSITIVE
- right end position:
- 123222
- centisome position:
- 65.290924
- Synonym(s):
Reactions associated
- FUMARYLACETOACETASE-RXN
- original_genome
- automated-name-match
- original_genome