Difference between revisions of "CHC T00009349001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00001389001_1 == * Synonym(s): == Reactions associated == * RXN-8999 ** pantograph-a.taliana * RXN0-5180 ** pantograph-a....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10818 CPD-10818] == * smiles: ** C=C(CCOP(=O)([O-])[O-])C * common name: ** isopentenyl pho...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00001389001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10818 CPD-10818] ==
 +
* smiles:
 +
** C=C(CCOP(=O)([O-])[O-])C
 +
* common name:
 +
** isopentenyl phosphate
 +
* inchi key:
 +
** InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 164.097   
 
* Synonym(s):
 
* Synonym(s):
 +
** isopentenyl-P
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8999]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
* [[RXN-10067]]
* [[RXN0-5180]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[a.taliana]]
+
* [[RXN-10068]]
== Pathways associated ==
+
* [[PWY-5785]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-8999|RXN0-5180}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-5785}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123422 44123422]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65078 65078]
 +
{{#set: smiles=C=C(CCOP(=O)([O-])[O-])C}}
 +
{{#set: common name=isopentenyl phosphate}}
 +
{{#set: inchi key=InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=164.097    }}
 +
{{#set: common name=isopentenyl-P}}
 +
{{#set: produced by=RXN-10067}}
 +
{{#set: consumed or produced by=RXN-10068}}

Revision as of 11:21, 18 January 2018

Metabolite CPD-10818

  • smiles:
    • C=C(CCOP(=O)([O-])[O-])C
  • common name:
    • isopentenyl phosphate
  • inchi key:
    • InChIKey=QMZRXYCCCYYMHF-UHFFFAOYSA-L
  • molecular weight:
    • 164.097
  • Synonym(s):
    • isopentenyl-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.