Difference between revisions of "PWY-7219"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006126001_1 == * Synonym(s): == Reactions associated == * IPPISOM-RXN ** pantograph-galdieria.sulphuraria ** pantograph-a.t...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == * smiles: ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C | ||
| + | * inchi key: | ||
| + | ** InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K | ||
| + | * common name: | ||
| + | ** presqualene diphosphate | ||
| + | * molecular weight: | ||
| + | ** 583.66 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13724]] |
| − | + | * [[RXN66-281]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-12263]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03428 C03428] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57310 57310] | ||
| + | * METABOLIGHTS : MTBLC57310 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244634 25244634] | ||
| + | * HMDB : HMDB01278 | ||
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K}} | ||
| + | {{#set: common name=presqualene diphosphate}} | ||
| + | {{#set: molecular weight=583.66 }} | ||
| + | {{#set: consumed by=RXN-13724|RXN66-281}} | ||
| + | {{#set: produced by=RXN-12263}} | ||
Revision as of 11:22, 18 January 2018
Contents
Metabolite CPD-465
- smiles:
- CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C
- inchi key:
- InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K
- common name:
- presqualene diphosphate
- molecular weight:
- 583.66
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C" cannot be used as a page name in this wiki.
