Difference between revisions of "RIBONUCLEOSIDE-DIP-REDUCTII-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] == * smiles: ** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12184 RXN-12184] == * direction: ** LEFT-TO-RIGHT * common name: ** long-chain-fatty-acid-CoA l...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12184 RXN-12184] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K
+
 
* common name:
 
* common name:
−
** presqualene diphosphate
+
** long-chain-fatty-acid-CoA ligase
−
* molecular weight:
+
* ec number:
−
** 583.66   
+
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13724]]
+
* With identifiers:
−
* [[RXN66-281]]
+
** 1 [[ATP]][c] '''+''' 1 [[CPD-17637]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-17638]][c] '''+''' 1 [[AMP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-12263]]
+
** 1 ATP[c] '''+''' 1 7-hydroxylaurate[c] '''+''' 1 coenzyme A[c] '''=>''' 1 diphosphate[c] '''+''' 1 7-hydroxylauroyl-CoA[c] '''+''' 1 AMP[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00008811001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00008811001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[CHC_T00009428001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00009428001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[CHC_T00008500001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00008160001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733]
 +
** '''4''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03428 C03428]
+
{{#set: common name=long-chain-fatty-acid-CoA ligase}}
−
* CHEBI:
+
{{#set: ec number=EC-6.2.1.3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57310 57310]
+
{{#set: gene associated=CHC_T00008811001_1|CHC_T00008811001|CHC_T00009428001_1|CHC_T00009428001|CHC_T00008500001_1|CHC_T00008160001_1}}
−
* METABOLIGHTS : MTBLC57310
+
{{#set: in pathway=PWY-6733}}
−
* PUBCHEM:
+
{{#set: reconstruction category=orthology}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244634 25244634]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB01278
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(C)C)C)(C1COP(OP([O-])([O-])=O)([O-])=O)C))C)C)C}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=ATZKAUGGNMSCCY-VYCBRMPGSA-K}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=presqualene diphosphate}}
+
{{#set: reconstruction source=original_genome}}
−
{{#set: molecular weight=583.66    }}
+
−
{{#set: consumed by=RXN-13724|RXN66-281}}
+
−
{{#set: produced by=RXN-12263}}
+

Revision as of 12:24, 18 January 2018

Reaction RXN-12184

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • long-chain-fatty-acid-CoA ligase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 7-hydroxylaurate[c] + 1 coenzyme A[c] => 1 diphosphate[c] + 1 7-hydroxylauroyl-CoA[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6733, sporopollenin precursors biosynthesis: PWY-6733
    • 4 reactions found over 18 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RIBONUCLEOSIDE-DIP-REDUCTII-RXN&oldid=7901"