Difference between revisions of "HECT-Ubiquitin-carrier-protein-E3-L-cys"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856] ==
* smiles:
+
* taxonomic range:
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
 
* common name:
 
* common name:
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** ubiquinol-9 biosynthesis (prokaryotic)
* molecular weight:
+
** 185.136   
+
 
* Synonym(s):
 
* Synonym(s):
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
+
** Q9 biosynthesis
 +
** ubiquinone-9 biosynthesis (prokaryotic)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14014]]
+
* '''2''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[2.1.1.64-RXN]]
* [[DIHYDRODIPICSYN-RXN]]
+
** [[2.5.1.39-RXN]]
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''6''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9239 RXN-9239]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9238 RXN-9238]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9240 RXN-9240]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9241 RXN-9241]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9243 RXN-9243]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: common name=ubiquinol-9 biosynthesis (prokaryotic)}}
* CHEBI:
+
{{#set: common name=Q9 biosynthesis|ubiquinone-9 biosynthesis (prokaryotic)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
{{#set: reaction found=2}}
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
{{#set: reaction not found=6}}
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: molecular weight=185.136    }}
+
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
{{#set: consumed by=RXN-14014}}
+
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Revision as of 12:25, 18 January 2018

Pathway PWY-5856

  • taxonomic range:
  • common name:
    • ubiquinol-9 biosynthesis (prokaryotic)
  • Synonym(s):
    • Q9 biosynthesis
    • ubiquinone-9 biosynthesis (prokaryotic)

Reaction(s) found

Reaction(s) not found

External links