Difference between revisions of "Oxo-glutarate-dehydrogenase-lipoyl"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-cyclopropane-Δ1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2544 RXN1G-2544] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** cyclic-2,3-O-oxalyl-L-threonate
+
** cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
−
* molecular weight:
+
** Cyclopropane-fatty-acyl-phospholipid synthase family
−
** 189.101   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.1.1.79 EC-2.1.1.79]
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-cyclic oxalyl theronolactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12872]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[cis-D19-37-MOH-38-Me-C57-1-ACPs]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[cis-19-CP-37-Mex-38-Me-C59-ACPs]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c]
−
* [[RXN-12869]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 S-adenosyl-L-methionine[c] '''+''' 1 a cis-delta19-37-methoxy-38-methyl-C57:1-[acp][c] '''=>''' 1 H+[c] '''+''' 1 a cis-methoxy-C59-meroacyl-[acp][c] '''+''' 1 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00005488001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00009019001]]
 +
** ORIGINAL_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[CHC_T00003092001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''29''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
+
{{#set: common name=cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase}}
−
{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
+
{{#set: common name=Cyclopropane-fatty-acyl-phospholipid synthase family}}
−
{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
+
{{#set: ec number=EC-2.1.1.79}}
−
{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
+
{{#set: gene associated=CHC_T00005488001_1|CHC_T00009019001|CHC_T00003092001_1}}
−
{{#set: molecular weight=189.101    }}
+
{{#set: in pathway=PWYG-321}}
−
{{#set: common name=2,3-cyclic oxalyl theronolactone}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: consumed by=RXN-12872}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: produced by=RXN-12869}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=original_genome}}

Revision as of 12:25, 18 January 2018

Reaction RXN1G-2544

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase
    • Cyclopropane-fatty-acyl-phospholipid synthase family
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 29 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-cyclopropane-Δ19-37-hydroxy-38-methyl-C57:1-[acp] synthase" cannot be used as a page name in this wiki.






Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Oxo-glutarate-dehydrogenase-lipoyl&oldid=7987"