Difference between revisions of "CHC T00009232001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-139 TRANS-RXN-139] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-139 TRANS-RXN-139] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
−
* common name:
+
−
** α,ω-9Z-octadecenedioate
+
−
* molecular weight:
+
−
** 310.433   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α,ω-9Z-octadecenedioic acid
 
−
** 1,18-9Z-octadecenedioic acid
 
−
** octadecenedioate
 
−
** 18-carboxyl oleate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16418]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CL-]][e] '''<=>''' 1 [[CL-]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 chloride[e] '''<=>''' 1 chloride[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00005091001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00007738001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00001610001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: gene associated=CHC_T00005091001_1|CHC_T00007738001_1|CHC_T00001610001_1}}
−
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=&alpha;,&omega;-9Z-octadecenedioate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=310.433    }}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
−
{{#set: common name=&alpha;,&omega;-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
−
{{#set: consumed by=RXN-16418}}
+

Revision as of 11:25, 18 January 2018

Reaction TRANS-RXN-139

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 chloride[e] <=> 1 chloride[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009232001_1&oldid=8004"