Difference between revisions of "CHC T00001993001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4209 RXN-4209] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4209 RXN-4209] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15668 CPD-15668] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
+
** InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
 +
* common name:
 +
** 4-cis-undecenoyl-CoA
 +
* molecular weight:
 +
** 929.765   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4Z-undecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14775]]
−
** 2 [[PROTON]][c] '''+''' 1 [[CPD-4125]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-4126]][c] '''+''' 2 [[WATER]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-14774]]
−
** 2 H+[c] '''+''' 1 avenasterol[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 oxygen[c] '''=>''' 1 5-dehydroavenasterol[c] '''+''' 2 H2O[c] '''+''' 2 a ferricytochrome b5[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00006481001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
+
−
** '''7''' reactions found over '''36''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07486 R07486]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658173 90658173]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: ec number=EC-1.14.19.20}}
+
{{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J}}
−
{{#set: gene associated=CHC_T00006481001_1}}
+
{{#set: common name=4-cis-undecenoyl-CoA}}
−
{{#set: in pathway=PWY-2541}}
+
{{#set: molecular weight=929.765    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=4Z-undecenoyl-CoA}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-14775}}
−
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+
{{#set: produced by=RXN-14774}}

Revision as of 11:25, 18 January 2018

Metabolite CPD-15668

  • smiles:
    • CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=AFMMIIQKXQNEDN-NSDZGHCESA-J
  • common name:
    • 4-cis-undecenoyl-CoA
  • molecular weight:
    • 929.765
  • Synonym(s):
    • 4Z-undecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00001993001_1&oldid=8020"