Difference between revisions of "H2CO3"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DERMATAN-L-IDURONATE DERMATAN-L-IDURONATE] == * common name: ** [dermatan]-α-L-iduronate...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11523 CPD-11523] == |
| + | * smiles: | ||
| + | ** CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4) | ||
| + | * inchi key: | ||
| + | ** InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** OPC6-3-hydroxyacyl-CoA |
| + | * molecular weight: | ||
| + | ** 1027.866 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10702]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10704]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237226 44237226] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}} |
| + | {{#set: inchi key=InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J}} | ||
| + | {{#set: common name=OPC6-3-hydroxyacyl-CoA}} | ||
| + | {{#set: molecular weight=1027.866 }} | ||
| + | {{#set: consumed by=RXN-10702}} | ||
| + | {{#set: produced by=RXN-10704}} | ||
Revision as of 11:25, 18 January 2018
Contents
Metabolite CPD-11523
- smiles:
- CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
- inchi key:
- InChIKey=OMDQVIUYDJAWHX-ZMWLRFEFSA-J
- common name:
- OPC6-3-hydroxyacyl-CoA
- molecular weight:
- 1027.866
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.
