|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7904 RXN-7904] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) |
| + | * inchi key: |
| + | ** InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L |
| * common name: | | * common name: |
− | ** long-chain-fatty-acid-CoA ligase | + | ** S-methyl-5-thio-α-D-ribose 1-phosphate |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3] | + | ** 258.182 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 5-methylthioribose-1-phosphate |
| + | ** S5-methyl-5-thio-D-ribose-1-phosphate |
| + | ** 5-methylthio-D-ribose-1-phosphate |
| + | ** 5-MTR-1-P |
| + | ** 1-phosphomethylthioribose |
| + | ** 1-phospho-5-S-methylthioribose |
| + | ** 1-PMTR |
| + | ** 1-phospho-5-S-methylthio-α-D-ribofuranoside |
| + | ** S-methyl-5-thio-α-D-ribose 1-phosphate |
| + | ** S-methyl-5-thio-D-ribose 1-phosphate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[CO-A]][c] '''+''' 1 [[Long-Chain-Fatty-Acids]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c]
| + | * [[5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 coenzyme A[c] '''+''' 1 a long-chain fatty acid[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 a long-chain acyl-CoA[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00009428001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008811001]]
| + | |
− | ** ORIGINAL_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[CHC_T00008160001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008500001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008811001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00009428001]]
| + | |
− | ** ORIGINAL_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways == | + | |
− | * [[PWY-6803]], phosphatidylcholine acyl editing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6803 PWY-6803]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-5143]], long-chain fatty acid activation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5143 PWY-5143]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY-6873]], long chain fatty acid ester synthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6873 PWY-6873]
| + | |
− | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7033]], alkane biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7033 PWY-7033]
| + | |
− | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5885]], wax esters biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5885 PWY-5885]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[original_genome]]
| + | |
| == External links == | | == External links == |
− | * PIR: | + | * BIGG : 5mdr1p |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A36275 A36275] | + | * PUBCHEM: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A54901 A54901] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266677 45266677] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A70117 A70117]
| + | * HMDB : HMDB00963 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B54901 B54901]
| + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B75585 B75585] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04188 C04188] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C70762 C70762]
| + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C71361 C71361]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58533 58533] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C75364 C75364]
| + | * METABOLIGHTS : MTBLC58533 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D69649 D69649]
| + | {{#set: smiles=CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O)}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D72605 D72605]
| + | {{#set: inchi key=InChIKey=JTFITTQBRJDSTL-KVTDHHQDSA-L}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=F86707 F86707]
| + | {{#set: common name=S-methyl-5-thio-α-D-ribose 1-phosphate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G81798 G81798]
| + | {{#set: molecular weight=258.182 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H64041 H64041]
| + | {{#set: common name=5-methylthioribose-1-phosphate|S5-methyl-5-thio-D-ribose-1-phosphate|5-methylthio-D-ribose-1-phosphate|5-MTR-1-P|1-phosphomethylthioribose|1-phospho-5-S-methylthioribose|1-PMTR|1-phospho-5-S-methylthio-α-D-ribofuranoside|S-methyl-5-thio-α-D-ribose 1-phosphate|S-methyl-5-thio-D-ribose 1-phosphate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H69274 H69274]
| + | {{#set: produced by=5-METHYLTHIOADENOSINE-PHOSPHORYLASE-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H70173 H70173]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H81068 H81068]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JE0262 JE0262]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0202 JX0202]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0205 JX0205]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S23052 S23052]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S23467 S23467]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S41589 S41589]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S49487 S49487]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S56060 S56060]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S74984 S74984]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T01875 T01875]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T02834 T02834]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07928 T07928]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07929 T07929]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07944 T07944]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T08182 T08182]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T08904 T08904]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T34994 T34994]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T35430 T35430]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T35513 T35513]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T39766 T39766]
| + | |
− | * LIGAND-RXN: | + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00390 R00390] | + | |
− | * UNIPROT: | + | |
− | ** [http://www.uniprot.org/uniprot/O60135 O60135] | + | |
− | ** [http://www.uniprot.org/uniprot/Q9X7Z0 Q9X7Z0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X7Y5 Q9X7Y5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZBW6 Q9ZBW6] | + | |
− | ** [http://www.uniprot.org/uniprot/Q9T0A0 Q9T0A0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9T009 Q9T009]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96338 Q96338]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96538 Q96538]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q96537 Q96537]
| + | |
− | ** [http://www.uniprot.org/uniprot/O15840 O15840]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81614 O81614]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73004 P73004]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47912 P47912]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8JZR0 Q8JZR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69452 P69452]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69451 P69451]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02602 Q02602]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30624 P30624]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33124 P33124]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33121 P33121]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JYJ7 Q9JYJ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51539 O51539]
| + | |
− | ** [http://www.uniprot.org/uniprot/O30039 O30039]
| + | |
− | ** [http://www.uniprot.org/uniprot/P44446 P44446]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTK0 Q9JTK0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CHR0 Q9CHR0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YCF0 Q9YCF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P94547 P94547]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RTR4 Q9RTR4]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83181 O83181]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10776 Q10776]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RYK3 Q9RYK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39002 P39002]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51162 O51162]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39518 P39518]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18163 P18163]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=long-chain-fatty-acid-CoA ligase}} | + | |
− | {{#set: ec number=EC-6.2.1.3}} | + | |
− | {{#set: gene associated=CHC_T00009428001_1|CHC_T00008811001|CHC_T00008160001_1|CHC_T00008500001_1|CHC_T00008811001_1|CHC_T00009428001}} | + | |
− | {{#set: in pathway=PWY-6803|PWY-5143|PWY-6873|PWY-7033|PWY-5885}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=galdieria.sulphuraria}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=original_genome}}
| + | |