Difference between revisions of "CPD-10267"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == * smiles: ** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5895 PWY-5895] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33882 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5895 PWY-5895] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33882 TAX-33882]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-838 TAX-838]
−
** InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J
+
 
* common name:
 
* common name:
−
** decanoyl-CoA
+
** menaquinol-13 biosynthesis
−
* molecular weight:
+
−
** 917.754   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** vitamin K2 biosynthesis
 +
** menaquinone-13 biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''1''' reaction(s) found
−
* [[RXN-13614]]
+
** [[RXN-9366]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
−
* [[RXN-14274]]
+
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9365 RXN-9365]
 
== External links  ==
 
== External links  ==
−
* BIGG : dcacoa
+
{{#set: taxonomic range=TAX-33882}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-838}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244140 25244140]
+
{{#set: common name=menaquinol-13 biosynthesis}}
−
* HMDB : HMDB06404
+
{{#set: common name=vitamin K2 biosynthesis|menaquinone-13 biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05274 C05274]
+
{{#set: reaction not found=1}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61430 61430]
+
−
* METABOLIGHTS : MTBLC61430
+
−
{{#set: smiles=CCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=CNKJPHSEFDPYDB-HSJNEKGZSA-J}}
+
−
{{#set: common name=decanoyl-CoA}}
+
−
{{#set: molecular weight=917.754    }}
+
−
{{#set: produced by=RXN-13614}}
+
−
{{#set: consumed or produced by=RXN-14274}}
+

Revision as of 11:26, 18 January 2018

Pathway PWY-5895

  • taxonomic range:
  • common name:
    • menaquinol-13 biosynthesis
  • Synonym(s):
    • vitamin K2 biosynthesis
    • menaquinone-13 biosynthesis

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-10267&oldid=8063"