Difference between revisions of "PWY-6115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6840 PWY-6840] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6840 PWY-6840] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** homoglutathione biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''1''' reaction(s) found |
− | == Reaction(s) | + | ** [[GLUTCYSLIG-RXN]] |
− | + | == Reaction(s) not found == | |
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=HOMOGLUTATHIONE-SYNTHASE-RXN HOMOGLUTATHIONE-SYNTHASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3803}} | |
− | + | {{#set: common name=homoglutathione biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:26, 18 January 2018
Pathway PWY-6840
- taxonomic range:
- common name:
- homoglutathione biosynthesis
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found